C26H21N3OS — CID 3698104
5-(1-ethylquinolin-2-ylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 3698104) has the molecular formula C26H21N3OS and a molecular weight of 423.54 g/mol. Its IUPAC name is 5-(1-ethylquinolin-2-ylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(1-ethylquinolin-2-ylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3698104 |
| Molecular Formula | C26H21N3OS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-(1-ethylquinolin-2-ylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=C2C(=O)N(c3ccccc3)C(=S)N2c2ccccc2)C=Cc2ccccc21 |
| InChI | InChI=1S/C26H21N3OS/c1-2-27-22-16-10-9-11-19(22)17-18-23(27)24-25(30)29(21-14-7-4-8-15-21)26(31)28(24)20-12-5-3-6-13-20/h3-18H,2H2,1H3 |
| InChIKey | KVGUSCLCSMCMTB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|