C19H16N4O2S2 — CID 36987537
4-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 36987537) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 36987537 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | O=c1cc(CSc2nnnn2Cc2cccs2)c2cc3c(cc2o1)CCC3 |
| InChI | InChI=1S/C19H16N4O2S2/c24-18-9-14(16-7-12-3-1-4-13(12)8-17(16)25-18)11-27-19-20-21-22-23(19)10-15-5-2-6-26-15/h2,5-9H,1,3-4,10-11H2 |
| InChIKey | NTVKWQHNWZZTKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|