C14H12BrNO4S — CID 36992788
1-(5-bromothiophen-2-yl)-2-(2,6-dimethyl-3-nitrophenoxy)ethanone (PubChem CID 36992788) has the molecular formula C14H12BrNO4S and a molecular weight of 370.22 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-(2,6-dimethyl-3-nitrophenoxy)ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-(2,6-dimethyl-3-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 36992788 |
| Molecular Formula | C14H12BrNO4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-(2,6-dimethyl-3-nitrophenoxy)ethanone |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1OCC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrNO4S/c1-8-3-4-10(16(18)19)9(2)14(8)20-7-11(17)12-5-6-13(15)21-12/h3-6H,7H2,1-2H3 |
| InChIKey | BICCFEQFOJHODR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|