C22H19F3N4O6 — CID 37005286
ethyl (1S,2S,3S)-2-[[(E)-(3-nitrophenyl)methylideneamino]carbamoyl]-3-[[3-(trifluoromethyl)phenyl]carbamoyl]cyclopropane-1-carboxylate (PubChem CID 37005286) has the molecular formula C22H19F3N4O6 and a molecular weight of 492.41 g/mol. Its IUPAC name is ethyl (1S,2S,3S)-2-[[(E)-(3-nitrophenyl)methylideneamino]carbamoyl]-3-[[3-(trifluoromethyl)phenyl]carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S)-2-[[(E)-(3-nitrophenyl)methylideneamino]carbamoyl]-3-[[3-(trifluoromethyl)phenyl]carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 37005286 |
| Molecular Formula | C22H19F3N4O6 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | ethyl (1S,2S,3S)-2-[[(E)-(3-nitrophenyl)methylideneamino]carbamoyl]-3-[[3-(trifluoromethyl)phenyl]carbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)N/N=C/c2cccc([N+](=O)[O-])c2)[C@@H]1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N4O6/c1-2-35-21(32)18-16(19(30)27-14-7-4-6-13(10-14)22(23,24)25)17(18)20(31)28-26-11-12-5-3-8-15(9-12)29(33)34/h3-11,16-18H,2H2,1H3,(H,27,30)(H,28,31)/b26-11+/t16-,17-,18-/m0/s1 |
| InChIKey | HDWFUMKKMNGEDS-RPFGUHSMSA-N |
| XLogP | 3.13 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|