C31H26N2O2 — CID 3701334
(R,S)-BisPh-mebBox (PubChem CID 3701334) has the molecular formula C31H26N2O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (R,S)-BisPh-mebBox |
|---|---|
| PubChem CID | 3701334 |
| Molecular Formula | C31H26N2O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C1=CC=C(C=C1)C2C(OC(=N2)CC3=NC(C(O3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
| InChI | InChI=1S/C31H26N2O2/c1-5-13-22(14-6-1)28-30(24-17-9-3-10-18-24)34-26(32-28)21-27-33-29(23-15-7-2-8-16-23)31(35-27)25-19-11-4-12-20-25/h1-20,28-31H,21H2 |
| InChIKey | BVEHHQYXICTXGR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 43.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | 677 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |