C12H19N5O4 — CID 3702277
8-(1,4-dihydroxybutan-2-ylamino)-1,3,7-trimethylpurine-2,6-dione (PubChem CID 3702277) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is 8-(1,4-dihydroxybutan-2-ylamino)-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-(1,4-dihydroxybutan-2-ylamino)-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3702277 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 8-(1,4-dihydroxybutan-2-ylamino)-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC(CO)CCO)n2C)n(C)c1=O |
| InChI | InChI=1S/C12H19N5O4/c1-15-8-9(16(2)12(21)17(3)10(8)20)14-11(15)13-7(6-19)4-5-18/h7,18-19H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | FYEQKPSVLXLEJX-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |