C14H25N6O3+ — CID 7196019
2-hydroxyethyl-[(2R)-2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]butyl]azanium (PubChem CID 7196019) has the molecular formula C14H25N6O3+ and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-hydroxyethyl-[(2R)-2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]butyl]azanium.
| Compound Name | 2-hydroxyethyl-[(2R)-2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]butyl]azanium |
|---|---|
| PubChem CID | 7196019 |
| Molecular Formula | C14H25N6O3+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-hydroxyethyl-[(2R)-2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]butyl]azanium |
| SMILES | CC[C@H](C[NH2+]CCO)Nc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C14H24N6O3/c1-5-9(8-15-6-7-21)16-13-17-11-10(18(13)2)12(22)20(4)14(23)19(11)3/h9,15,21H,5-8H2,1-4H3,(H,16,17)/p+1/t9-/m1/s1 |
| InChIKey | PFCKVALBOLBBTQ-SECBINFHSA-O |
| XLogP | -2.28 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|