C21H35N5O2 — CID 37026778
(3R)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 37026778) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3R)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 37026778 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (3R)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | CCC(CC)[C@@H](CNC(=O)[C@@H]1CCCN(c2cnccn2)C1)N1CCOCC1 |
| InChI | InChI=1S/C21H35N5O2/c1-3-17(4-2)19(25-10-12-28-13-11-25)14-24-21(27)18-6-5-9-26(16-18)20-15-22-7-8-23-20/h7-8,15,17-19H,3-6,9-14,16H2,1-2H3,(H,24,27)/t18-,19-/m1/s1 |
| InChIKey | BUAQLXJKGNRBIB-RTBURBONSA-N |
| XLogP | 1.95 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |