C17H14N2O — CID 3703705
2-(3-methylphenyl)-5-(2-phenylethenyl)-1,3,4-oxadiazole (PubChem CID 3703705) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(3-methylphenyl)-5-(2-phenylethenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-methylphenyl)-5-(2-phenylethenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3703705 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-(3-methylphenyl)-5-(2-phenylethenyl)-1,3,4-oxadiazole |
| SMILES | Cc1cccc(-c2nnc(C=Cc3ccccc3)o2)c1 |
| InChI | InChI=1S/C17H14N2O/c1-13-6-5-9-15(12-13)17-19-18-16(20-17)11-10-14-7-3-2-4-8-14/h2-12H,1H3 |
| InChIKey | AMERMDSKVHITHY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |