C17H15N3O2S2 — CID 3704626
2-(4-methoxyphenyl)-N-[4-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)phenyl]acetamide (PubChem CID 3704626) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3704626 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(-c3n[nH]c(=S)s3)cc2)cc1 |
| InChI | InChI=1S/C17H15N3O2S2/c1-22-14-8-2-11(3-9-14)10-15(21)18-13-6-4-12(5-7-13)16-19-20-17(23)24-16/h2-9H,10H2,1H3,(H,18,21)(H,20,23) |
| InChIKey | AKUBBZPWFPUJQF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|