C17H22F2N2O4 — CID 3704873
1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]aziridine-2-carboxamide (PubChem CID 3704873) has the molecular formula C17H22F2N2O4 and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]aziridine-2-carboxamide.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]aziridine-2-carboxamide |
|---|---|
| PubChem CID | 3704873 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]aziridine-2-carboxamide |
| SMILES | CC1(C)OCC(CNC(=O)C2CN2Cc2cccc(OC(F)F)c2)O1 |
| InChI | InChI=1S/C17H22F2N2O4/c1-17(2)23-10-13(25-17)7-20-15(22)14-9-21(14)8-11-4-3-5-12(6-11)24-16(18)19/h3-6,13-14,16H,7-10H2,1-2H3,(H,20,22) |
| InChIKey | OUICTXAXRWHGMQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|