C20H22F2N2O4 — CID 3606191
1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(3,5-dimethoxyphenyl)methyl]aziridine-2-carboxamide (PubChem CID 3606191) has the molecular formula C20H22F2N2O4 and a molecular weight of 392.40 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(3,5-dimethoxyphenyl)methyl]aziridine-2-carboxamide.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(3,5-dimethoxyphenyl)methyl]aziridine-2-carboxamide |
|---|---|
| PubChem CID | 3606191 |
| Molecular Formula | C20H22F2N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-N-[(3,5-dimethoxyphenyl)methyl]aziridine-2-carboxamide |
| SMILES | COc1cc(CNC(=O)C2CN2Cc2cccc(OC(F)F)c2)cc(OC)c1 |
| InChI | InChI=1S/C20H22F2N2O4/c1-26-16-7-14(8-17(9-16)27-2)10-23-19(25)18-12-24(18)11-13-4-3-5-15(6-13)28-20(21)22/h3-9,18,20H,10-12H2,1-2H3,(H,23,25) |
| InChIKey | FZSDEWAVSGMKLV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|