C17H12N4O5S2 — CID 3706197
4-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide (PubChem CID 3706197) has the molecular formula C17H12N4O5S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide.
| Compound Name | 4-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 3706197 |
| Molecular Formula | C17H12N4O5S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide |
| SMILES | O=C(NN1C(=O)CSC1=S)c1ccc(/N=C/c2cc([N+](=O)[O-])ccc2O)cc1 |
| InChI | InChI=1S/C17H12N4O5S2/c22-14-6-5-13(21(25)26)7-11(14)8-18-12-3-1-10(2-4-12)16(24)19-20-15(23)9-28-17(20)27/h1-8,22H,9H2,(H,19,24)/b18-8+ |
| InChIKey | CGAGKHYZZZBCCA-QGMBQPNBSA-N |
| XLogP | 2.56 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|