C20H21N7O4 — CID 3707275
[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]-(5-methyl-1-phenylpyrazol-4-yl)methanone (PubChem CID 3707275) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is [2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]-(5-methyl-1-phenylpyrazol-4-yl)methanone.
| Compound Name | [2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]-(5-methyl-1-phenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 3707275 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]-(5-methyl-1-phenylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C(=O)N2CCCN2C(=O)c2cnn(-c3ccccc3)c2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N7O4/c1-13-17(27(30)31)18(23(3)22-13)20(29)25-11-7-10-24(25)19(28)16-12-21-26(14(16)2)15-8-5-4-6-9-15/h4-6,8-9,12H,7,10-11H2,1-3H3 |
| InChIKey | CPTJIPAPKPBOTA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|