C24H21FN4O2 — CID 37077198
[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2R)-2-phenylmorpholin-4-yl]methanone (PubChem CID 37077198) has the molecular formula C24H21FN4O2 and a molecular weight of 416.46 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2R)-2-phenylmorpholin-4-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2R)-2-phenylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 37077198 |
| Molecular Formula | C24H21FN4O2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2R)-2-phenylmorpholin-4-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccccc2F)c1-n1cccc1)N1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H21FN4O2/c25-20-10-4-5-11-21(20)29-23(27-12-6-7-13-27)19(16-26-29)24(30)28-14-15-31-22(17-28)18-8-2-1-3-9-18/h1-13,16,22H,14-15,17H2/t22-/m0/s1 |
| InChIKey | ATQCVKIANMHGSG-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |