C19H19FN4O2 — CID 39699272
[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 39699272) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 39699272 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cnn(-c3ccccc3F)c2-n2cccc2)CCO1 |
| InChI | InChI=1S/C19H19FN4O2/c1-14-13-23(10-11-26-14)19(25)15-12-21-24(17-7-3-2-6-16(17)20)18(15)22-8-4-5-9-22/h2-9,12,14H,10-11,13H2,1H3/t14-/m0/s1 |
| InChIKey | BTLWRILPWAPBIF-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |