C15H28O2 — CID 3708293
2-(2,6-dimethylhept-5-enyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 3708293) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(2,6-dimethylhept-5-enyl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(2,6-dimethylhept-5-enyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 3708293 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-(2,6-dimethylhept-5-enyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CC(C)=CCCC(C)CC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H28O2/c1-12(2)7-6-8-13(3)9-14-16-10-15(4,5)11-17-14/h7,13-14H,6,8-11H2,1-5H3 |
| InChIKey | NBRLPXWLGXAHBK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|