C20H15ClN6O3S — CID 37083287
2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 37083287) has the molecular formula C20H15ClN6O3S and a molecular weight of 454.90 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 37083287 |
| Molecular Formula | C20H15ClN6O3S |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | C=CCn1c(SCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN6O3S/c1-2-11-26-18(13-3-7-15(21)8-4-13)23-25-20(26)31-12-17-22-24-19(30-17)14-5-9-16(10-6-14)27(28)29/h2-10H,1,11-12H2 |
| InChIKey | ZKLPSJMVMAZVKD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|