C19H17N3OS — CID 3708817
7,20-dimethyl-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one (PubChem CID 3708817) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 7,20-dimethyl-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one.
| Compound Name | 7,20-dimethyl-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one |
|---|---|
| PubChem CID | 3708817 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 7,20-dimethyl-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one |
| SMILES | Cc1nn2c(=O)c3c4c(sc3nc2c2ccccc12)CC(C)CC4 |
| InChI | InChI=1S/C19H17N3OS/c1-10-7-8-14-15(9-10)24-18-16(14)19(23)22-17(20-18)13-6-4-3-5-12(13)11(2)21-22/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | LRWQJHLFJIAUFX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|