C24H27N5O2S — CID 3692010
7-methyl-20-(2-morpholin-4-ylethylamino)-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one (PubChem CID 3692010) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is 7-methyl-20-(2-morpholin-4-ylethylamino)-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one.
| Compound Name | 7-methyl-20-(2-morpholin-4-ylethylamino)-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one |
|---|---|
| PubChem CID | 3692010 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 7-methyl-20-(2-morpholin-4-ylethylamino)-10-thia-1,12,21-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4(9),12,14,16,18,20-heptaen-2-one |
| SMILES | CC1CCc2c(sc3nc4c5ccccc5c(NCCN5CCOCC5)nn4c(=O)c23)C1 |
| InChI | InChI=1S/C24H27N5O2S/c1-15-6-7-18-19(14-15)32-23-20(18)24(30)29-22(26-23)17-5-3-2-4-16(17)21(27-29)25-8-9-28-10-12-31-13-11-28/h2-5,15H,6-14H2,1H3,(H,25,27) |
| InChIKey | CHPARBDWAZNSEQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|