C19H18N6O — CID 37089479
1-benzyl-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)triazole-4-carboxamide (PubChem CID 37089479) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-benzyl-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 37089479 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-benzyl-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H18N6O/c26-19(17-14-25(23-22-17)12-15-6-2-1-3-7-15)20-10-9-16-13-24-11-5-4-8-18(24)21-16/h1-8,11,13-14H,9-10,12H2,(H,20,26) |
| InChIKey | YBFLEQSBBJRCBS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |