C18H16Cl2N2O — CID 3709810
N-[(2,2-dichloro-1-phenylcyclopropyl)methylideneamino]-2-phenylacetamide (PubChem CID 3709810) has the molecular formula C18H16Cl2N2O and a molecular weight of 347.25 g/mol. Its IUPAC name is N-[(2,2-dichloro-1-phenylcyclopropyl)methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(2,2-dichloro-1-phenylcyclopropyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 3709810 |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-[(2,2-dichloro-1-phenylcyclopropyl)methylideneamino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN=CC1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C18H16Cl2N2O/c19-18(20)12-17(18,15-9-5-2-6-10-15)13-21-22-16(23)11-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,22,23) |
| InChIKey | DXYYUKZSQAXESZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|