C13H19N3O4S — CID 37134490
(5R)-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 37134490) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is (5R)-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R)-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 37134490 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (5R)-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)CN2C(=O)N[C@]3(CCSC3)C2=O)CCO1 |
| InChI | InChI=1S/C13H19N3O4S/c1-9-6-15(3-4-20-9)10(17)7-16-11(18)13(14-12(16)19)2-5-21-8-13/h9H,2-8H2,1H3,(H,14,19)/t9-,13+/m1/s1 |
| InChIKey | WDJLEJBPNFDDDA-RNCFNFMXSA-N |
| XLogP | -0.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|