C17H20FN3O4 — CID 95151894
(5S)-5-(2-fluorophenyl)-5-methyl-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 95151894) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is (5S)-5-(2-fluorophenyl)-5-methyl-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2-fluorophenyl)-5-methyl-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95151894 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (5S)-5-(2-fluorophenyl)-5-methyl-3-[2-[(2R)-2-methylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)CN2C(=O)N[C@@](C)(c3ccccc3F)C2=O)CCO1 |
| InChI | InChI=1S/C17H20FN3O4/c1-11-9-20(7-8-25-11)14(22)10-21-15(23)17(2,19-16(21)24)12-5-3-4-6-13(12)18/h3-6,11H,7-10H2,1-2H3,(H,19,24)/t11-,17+/m1/s1 |
| InChIKey | FDNXJYFSQDSJLW-DIFFPNOSSA-N |
| XLogP | 0.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|