C18H22FN3O4 — CID 52508667
(5S)-3-[2-[(2S)-2-ethylmorpholin-4-yl]-2-oxoethyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 52508667) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is (5S)-3-[2-[(2S)-2-ethylmorpholin-4-yl]-2-oxoethyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[(2S)-2-ethylmorpholin-4-yl]-2-oxoethyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52508667 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (5S)-3-[2-[(2S)-2-ethylmorpholin-4-yl]-2-oxoethyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@H]1CN(C(=O)CN2C(=O)N[C@@](C)(c3ccccc3F)C2=O)CCO1 |
| InChI | InChI=1S/C18H22FN3O4/c1-3-12-10-21(8-9-26-12)15(23)11-22-16(24)18(2,20-17(22)25)13-6-4-5-7-14(13)19/h4-7,12H,3,8-11H2,1-2H3,(H,20,25)/t12-,18-/m0/s1 |
| InChIKey | LDNBTGZXIKHGBU-SGTLLEGYSA-N |
| XLogP | 1.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|