C27H37N3O5 — CID 3713841
N'-(2-hexyl-2-hydroxyoctanoyl)-3-nitro-N-phenylbenzohydrazide (PubChem CID 3713841) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is N'-(2-hexyl-2-hydroxyoctanoyl)-3-nitro-N-phenylbenzohydrazide.
| Compound Name | N'-(2-hexyl-2-hydroxyoctanoyl)-3-nitro-N-phenylbenzohydrazide |
|---|---|
| PubChem CID | 3713841 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N'-(2-hexyl-2-hydroxyoctanoyl)-3-nitro-N-phenylbenzohydrazide |
| SMILES | CCCCCCC(O)(CCCCCC)C(=O)NN(C(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O5/c1-3-5-7-12-19-27(33,20-13-8-6-4-2)26(32)28-29(23-16-10-9-11-17-23)25(31)22-15-14-18-24(21-22)30(34)35/h9-11,14-18,21,33H,3-8,12-13,19-20H2,1-2H3,(H,28,32) |
| InChIKey | VATDKLDKZZWTDX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|