C16H13N3OS2 — CID 3714635
5-[(3-methylphenyl)diazenyl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3714635) has the molecular formula C16H13N3OS2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-[(3-methylphenyl)diazenyl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-methylphenyl)diazenyl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3714635 |
| Molecular Formula | C16H13N3OS2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 5-[(3-methylphenyl)diazenyl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=N/C2SC(=S)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C16H13N3OS2/c1-11-6-5-7-12(10-11)17-18-14-15(20)19(16(21)22-14)13-8-3-2-4-9-13/h2-10,14H,1H3/b18-17+ |
| InChIKey | GWRQVGANGOOTLM-ISLYRVAYSA-N |
| XLogP | 4.47 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|