C20H13F3N2OS — CID 3716381
2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 3716381) has the molecular formula C20H13F3N2OS and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | 2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3716381 |
| Molecular Formula | C20H13F3N2OS |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | COc1cccc(-c2csc(C(C#N)=Cc3ccccc3C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H13F3N2OS/c1-26-16-7-4-6-14(10-16)18-12-27-19(25-18)15(11-24)9-13-5-2-3-8-17(13)20(21,22)23/h2-10,12H,1H3 |
| InChIKey | FPWAEWXPQXEVTE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|