C26H23FN4O3S — CID 3716474
2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-(8-hydroxyquinolin-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 3716474) has the molecular formula C26H23FN4O3S and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-(8-hydroxyquinolin-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-(8-hydroxyquinolin-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3716474 |
| Molecular Formula | C26H23FN4O3S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-(8-hydroxyquinolin-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)c2ncccc12)c1csc(C2CCN(C(=O)Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C26H23FN4O3S/c27-18-5-3-16(4-6-18)14-23(33)31-12-9-17(10-13-31)26-30-21(15-35-26)25(34)29-20-7-8-22(32)24-19(20)2-1-11-28-24/h1-8,11,15,17,32H,9-10,12-14H2,(H,29,34) |
| InChIKey | OWKFGMIKEAZESI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|