C22H23N3O4 — CID 3716863
3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-oxopropanamide (PubChem CID 3716863) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-oxopropanamide.
| Compound Name | 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-oxopropanamide |
|---|---|
| PubChem CID | 3716863 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-oxopropanamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)C=C2NC(C)(C)Cc3ccccc32)ccc1O |
| InChI | InChI=1S/C22H23N3O4/c1-22(2)12-15-6-4-5-7-16(15)17(24-22)11-19(27)21(28)25-23-13-14-8-9-18(26)20(10-14)29-3/h4-11,13,24,26H,12H2,1-3H3,(H,25,28) |
| InChIKey | PYIBPUDFYSTBLA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|