C16H16ClN3O4S2 — CID 3717870
N-[4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioyl]furan-2-carboxamide (PubChem CID 3717870) has the molecular formula C16H16ClN3O4S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3717870 |
| Molecular Formula | C16H16ClN3O4S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-[4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1ccco1 |
| InChI | InChI=1S/C16H16ClN3O4S2/c17-12-3-5-13(6-4-12)26(22,23)20-9-7-19(8-10-20)16(25)18-15(21)14-2-1-11-24-14/h1-6,11H,7-10H2,(H,18,21,25) |
| InChIKey | RHDOSXLXXNQHRT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|