C15H23N5OS2 — CID 3719016
[2-(1-amino-3-methylsulfanylpropyl)-1,3-thiazol-4-yl]-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)methanone (PubChem CID 3719016) has the molecular formula C15H23N5OS2 and a molecular weight of 353.52 g/mol. Its IUPAC name is [2-(1-amino-3-methylsulfanylpropyl)-1,3-thiazol-4-yl]-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)methanone.
| Compound Name | [2-(1-amino-3-methylsulfanylpropyl)-1,3-thiazol-4-yl]-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)methanone |
|---|---|
| PubChem CID | 3719016 |
| Molecular Formula | C15H23N5OS2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-(1-amino-3-methylsulfanylpropyl)-1,3-thiazol-4-yl]-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)methanone |
| SMILES | CSCCC(N)c1nc(C(=O)N2CCCN3CCCN=C32)cs1 |
| InChI | InChI=1S/C15H23N5OS2/c1-22-9-4-11(16)13-18-12(10-23-13)14(21)20-8-3-7-19-6-2-5-17-15(19)20/h10-11H,2-9,16H2,1H3 |
| InChIKey | LRZCUYCVBYLSOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |