C15H16N4O3S2 — CID 3719927
1-(3-nitrophenyl)-3-[(5-propylthiophene-3-carbonyl)amino]thiourea (PubChem CID 3719927) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-[(5-propylthiophene-3-carbonyl)amino]thiourea.
| Compound Name | 1-(3-nitrophenyl)-3-[(5-propylthiophene-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 3719927 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-(3-nitrophenyl)-3-[(5-propylthiophene-3-carbonyl)amino]thiourea |
| SMILES | CCCc1cc(C(=O)NNC(=S)Nc2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C15H16N4O3S2/c1-2-4-13-7-10(9-24-13)14(20)17-18-15(23)16-11-5-3-6-12(8-11)19(21)22/h3,5-9H,2,4H2,1H3,(H,17,20)(H2,16,18,23) |
| InChIKey | NYYCRHSRKZYGML-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|