C17H21N3O — CID 3720168
1-(2-pyridin-3-ylethyl)-3-(2,4,5-trimethylphenyl)urea (PubChem CID 3720168) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2-pyridin-3-ylethyl)-3-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1-(2-pyridin-3-ylethyl)-3-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 3720168 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-(2-pyridin-3-ylethyl)-3-(2,4,5-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NCCc2cccnc2)cc1C |
| InChI | InChI=1S/C17H21N3O/c1-12-9-14(3)16(10-13(12)2)20-17(21)19-8-6-15-5-4-7-18-11-15/h4-5,7,9-11H,6,8H2,1-3H3,(H2,19,20,21) |
| InChIKey | HTYDJDSNSKMTOQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |