C16H15BrN2O2S — CID 3721355
2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carbonitrile (PubChem CID 3721355) has the molecular formula C16H15BrN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is 2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carbonitrile.
| Compound Name | 2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 3721355 |
| Molecular Formula | C16H15BrN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carbonitrile |
| SMILES | CCOc1cc(Br)cc(C=Nc2sc(C)c(C)c2C#N)c1O |
| InChI | InChI=1S/C16H15BrN2O2S/c1-4-21-14-6-12(17)5-11(15(14)20)8-19-16-13(7-18)9(2)10(3)22-16/h5-6,8,20H,4H2,1-3H3 |
| InChIKey | LRPVAVDSSHIEMW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|