C18H17ClF2N2O4 — CID 37223693
2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 37223693) has the molecular formula C18H17ClF2N2O4 and a molecular weight of 398.79 g/mol. Its IUPAC name is 2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 37223693 |
| Molecular Formula | C18H17ClF2N2O4 |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CNc1cc2c(cc1Cl)OCCCO2)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H17ClF2N2O4/c19-11-8-15-16(26-7-3-6-25-15)9-13(11)22-10-17(24)23-12-4-1-2-5-14(12)27-18(20)21/h1-2,4-5,8-9,18,22H,3,6-7,10H2,(H,23,24) |
| InChIKey | QYKNWFKOAFXURM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|