3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid

C12H11I3N2O4 — CID 3723

IUPAC3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid
SMILESCC(=O)NCc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I
InChIInChI=1S/C12H11I3N2O4/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)
InChIKeyVVDGWALACJEJKG-UHFFFAOYSA-N
MW627.94 g/mol
LogP2.79
Rot. Bonds4

About 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid

3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid (PubChem CID 3723) has the molecular formula C12H11I3N2O4 and a molecular weight of 627.94 g/mol. Its IUPAC name is 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid.

Molecular Properties

Compound Name3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid
PubChem CID3723
Molecular FormulaC12H11I3N2O4
Molecular Weight627.94 g/mol
Exact Mass627.79
IUPAC Name3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid
SMILESCC(=O)NCc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I
InChIInChI=1S/C12H11I3N2O4/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)
InChIKeyVVDGWALACJEJKG-UHFFFAOYSA-N
XLogP2.79
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500627.94
LogP ≤ 52.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid?
The IUPAC name of 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid (CID 3723) is 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid.
What is the SMILES notation for 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid?
The canonical SMILES for 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid is CC(=O)NCc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.
What is the InChIKey of 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid?
The InChIKey is VVDGWALACJEJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11I3N2O4/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21).
What are the key properties of 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid?
3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid has a molecular weight of 627.94 g/mol, XLogP of 2.79, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid is sourced from PubChem (CID 3723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).