About sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate
sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate (PubChem CID 23667529) has the molecular formula C11H8I3N2NaO4
and a molecular weight of 635.90 g/mol. Its IUPAC name is sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate.
Molecular Properties
| Compound Name | sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate |
| PubChem CID | 23667529 |
| Molecular Formula | C11H8I3N2NaO4 |
| Molecular Weight | 635.90 g/mol |
| Exact Mass | 635.75 |
| IUPAC Name | sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I.[Na+] |
| InChI | InChI=1S/C11H9I3N2O4.Na/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20;/h1-2H3,(H,15,18)(H,16,17)(H,19,20);/q;+1/p-1 |
| InChIKey | WCIMWHNSWLLELS-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.90 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate?
The IUPAC name of sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate (CID 23667529) is sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate.
What is the SMILES notation for sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate?
The canonical SMILES for sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate is CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I.[Na+].
What is the InChIKey of sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate?
The InChIKey is WCIMWHNSWLLELS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9I3N2O4.Na/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20;/h1-2H3,(H,15,18)(H,16,17)(H,19,20);/q;+1/p-1.
What are the key properties of sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate?
sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate has a molecular weight of 635.90 g/mol, XLogP of -1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate is sourced from PubChem (CID 23667529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).