C15H19F3N2O2 — CID 37231584
2-(3-cyclopentyloxyanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 37231584) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-(3-cyclopentyloxyanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(3-cyclopentyloxyanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 37231584 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(3-cyclopentyloxyanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNc1cccc(OC2CCCC2)c1)NCC(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O2/c16-15(17,18)10-20-14(21)9-19-11-4-3-7-13(8-11)22-12-5-1-2-6-12/h3-4,7-8,12,19H,1-2,5-6,9-10H2,(H,20,21) |
| InChIKey | JAQGECVWRJONOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |