C10H12N2O — CID 3724387
4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole (PubChem CID 3724387) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 3724387 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccccn2)=N1 |
| InChI | InChI=1S/C10H12N2O/c1-10(2)7-13-9(12-10)8-5-3-4-6-11-8/h3-6H,7H2,1-2H3 |
| InChIKey | ZANPCQHDEUORJP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |