C22H34N4O2S — CID 37252743
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide (PubChem CID 37252743) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 37252743 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CSCC(=O)N3CCCCC3)c(C)c2)CC1 |
| InChI | InChI=1S/C22H34N4O2S/c1-3-24-11-13-25(14-12-24)19-7-8-20(18(2)15-19)23-21(27)16-29-17-22(28)26-9-5-4-6-10-26/h7-8,15H,3-6,9-14,16-17H2,1-2H3,(H,23,27) |
| InChIKey | DABNSYJVKBRFAP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|