C20H26F2N4O5S — CID 3725567
dimethyl 2-[[4-[2-(2,4-difluoroanilino)-2-oxoethyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate (PubChem CID 3725567) has the molecular formula C20H26F2N4O5S and a molecular weight of 472.51 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-(2,4-difluoroanilino)-2-oxoethyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[4-[2-(2,4-difluoroanilino)-2-oxoethyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate |
|---|---|
| PubChem CID | 3725567 |
| Molecular Formula | C20H26F2N4O5S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | dimethyl 2-[[4-[2-(2,4-difluoroanilino)-2-oxoethyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate |
| SMILES | COC(=O)CC(NC(=S)N1CCCN(CC(=O)Nc2ccc(F)cc2F)CC1)C(=O)OC |
| InChI | InChI=1S/C20H26F2N4O5S/c1-30-18(28)11-16(19(29)31-2)24-20(32)26-7-3-6-25(8-9-26)12-17(27)23-15-5-4-13(21)10-14(15)22/h4-5,10,16H,3,6-9,11-12H2,1-2H3,(H,23,27)(H,24,32) |
| InChIKey | BAGGEKFCUKJNJM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|