C24H27N3O3 — CID 37276622
N-cyclopropyl-4-[(E)-3-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-3-oxoprop-1-enyl]benzamide (PubChem CID 37276622) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 37276622 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)/C=C/c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-16-5-4-6-17(2)23(16)26-21(28)15-27(3)22(29)14-9-18-7-10-19(11-8-18)24(30)25-20-12-13-20/h4-11,14,20H,12-13,15H2,1-3H3,(H,25,30)(H,26,28)/b14-9+ |
| InChIKey | LNVXZZSTOGUDOL-NTEUORMPSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|