C28H33N3O4 — CID 55566510
N-cyclopropyl-4-[(E)-3-[[2-(2,3-dimethylanilino)-2-oxoethyl]-(oxolan-2-ylmethyl)amino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55566510) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[[2-(2,3-dimethylanilino)-2-oxoethyl]-(oxolan-2-ylmethyl)amino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[[2-(2,3-dimethylanilino)-2-oxoethyl]-(oxolan-2-ylmethyl)amino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55566510 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[[2-(2,3-dimethylanilino)-2-oxoethyl]-(oxolan-2-ylmethyl)amino]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1cccc(NC(=O)CN(CC2CCCO2)C(=O)/C=C/c2ccc(C(=O)NC3CC3)cc2)c1C |
| InChI | InChI=1S/C28H33N3O4/c1-19-5-3-7-25(20(19)2)30-26(32)18-31(17-24-6-4-16-35-24)27(33)15-10-21-8-11-22(12-9-21)28(34)29-23-13-14-23/h3,5,7-12,15,23-24H,4,6,13-14,16-18H2,1-2H3,(H,29,34)(H,30,32)/b15-10+ |
| InChIKey | ZSJVLQKGOIOBGJ-XNTDXEJSSA-N |
| XLogP | 3.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|