C17H12O7S2-2 — CID 3728187
4-[(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzene-1,3-disulfonate (PubChem CID 3728187) has the molecular formula C17H12O7S2-2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-[(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzene-1,3-disulfonate.
| Compound Name | 4-[(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 3728187 |
| Molecular Formula | C17H12O7S2-2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 4-[(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzene-1,3-disulfonate |
| SMILES | O=C1C(=Cc2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])CCc2ccccc21 |
| InChI | InChI=1S/C17H14O7S2/c18-17-13(6-5-11-3-1-2-4-15(11)17)9-12-7-8-14(25(19,20)21)10-16(12)26(22,23)24/h1-4,7-10H,5-6H2,(H,19,20,21)(H,22,23,24)/p-2 |
| InChIKey | NKFXQJRSEKSXNT-UHFFFAOYSA-L |
| XLogP | 1.71 |
| TPSA | 131.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|