C16H21FN4O2S — CID 37286588
N-[2-(4-fluorophenyl)ethyl]-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 37286588) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 37286588 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCCn1cnnc1SCC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-23-10-2-9-21-12-19-20-16(21)24-11-15(22)18-8-7-13-3-5-14(17)6-4-13/h3-6,12H,2,7-11H2,1H3,(H,18,22) |
| InChIKey | BXYZAHKKGKMTRJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|