C14H16F2N4O2S — CID 51287068
N-(3,5-difluorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 51287068) has the molecular formula C14H16F2N4O2S and a molecular weight of 342.37 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 51287068 |
| Molecular Formula | C14H16F2N4O2S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCCn1cnnc1SCC(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H16F2N4O2S/c1-22-4-2-3-20-9-17-19-14(20)23-8-13(21)18-12-6-10(15)5-11(16)7-12/h5-7,9H,2-4,8H2,1H3,(H,18,21) |
| InChIKey | RGDBAMDESNBNAG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|