C23H29N5O5S — CID 37312410
1-(2-methyl-5-nitrophenyl)sulfonyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-4-carboxamide (PubChem CID 37312410) has the molecular formula C23H29N5O5S and a molecular weight of 487.58 g/mol. Its IUPAC name is 1-(2-methyl-5-nitrophenyl)sulfonyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 37312410 |
| Molecular Formula | C23H29N5O5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)NCc2ccnc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C23H29N5O5S/c1-17-4-5-20(28(30)31)15-21(17)34(32,33)27-12-7-19(8-13-27)23(29)25-16-18-6-9-24-22(14-18)26-10-2-3-11-26/h4-6,9,14-15,19H,2-3,7-8,10-13,16H2,1H3,(H,25,29) |
| InChIKey | IQHBSPCIHUCFCC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|