C23H16N4O3 — CID 37316813
[4-(1,3,4-oxadiazol-2-yl)phenyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 37316813) has the molecular formula C23H16N4O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 37316813 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)Oc3ccc(-c4nnco4)cc3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H16N4O3/c1-15-25-20-13-17(9-12-21(20)27(15)18-5-3-2-4-6-18)23(28)30-19-10-7-16(8-11-19)22-26-24-14-29-22/h2-14H,1H3 |
| InChIKey | DNMQKMSZVODSLR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|