C13H16N4O — CID 3731870
N-(3-phenylpropyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 3731870) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 3731870 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-(3-phenylpropyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)NCCCc1ccccc1 |
| InChI | InChI=1S/C13H16N4O/c18-13(9-17-11-14-10-16-17)15-8-4-7-12-5-2-1-3-6-12/h1-3,5-6,10-11H,4,7-9H2,(H,15,18) |
| InChIKey | FXMSATSURBCREY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|